CAS 897958-99-5 appears in our catalog under these names: 5-Iodoisoindolin-1-one, 96%, 5-Iodoisoindolin-1-one, 96%, 96%, 1H-ISOINDOL-1-ONE, 2,3-DIHYDRO-5-IODO-, 96%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-iodo-2,3-dihydroisoindol-1-one (CAS 897958-99-5) is a chemical compound with the molecular formula C8H6INO and a molecular weight of 259.04 g/mol. IUPAC name: 5-iodo-2,3-dihydroisoindol-1-one. InChIKey: JDADBWJXAKXSIQ-UHFFFAOYSA-N.
| Molecular formula | C8H6INO |
|---|---|
| Molecular weight | 259.04 g/mol |
| IUPAC name | 5-iodo-2,3-dihydroisoindol-1-one |
| InChIKey | JDADBWJXAKXSIQ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)I)C(=O)N1 |
Computed by PubChem (NCBI)