CAS 866766-96-3 appears in our catalog under these names: 7-Iodoisoindolin-1-one 95%, 7-Iodoisoindolin-1-one, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
7-iodo-2,3-dihydroisoindol-1-one (CAS 866766-96-3) is a chemical compound with the molecular formula C8H6INO and a molecular weight of 259.04 g/mol. IUPAC name: 7-iodo-2,3-dihydroisoindol-1-one. InChIKey: QFKGKJNTMJUXMO-UHFFFAOYSA-N.
| Molecular formula | C8H6INO |
|---|---|
| Molecular weight | 259.04 g/mol |
| IUPAC name | 7-iodo-2,3-dihydroisoindol-1-one |
| InChIKey | QFKGKJNTMJUXMO-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)I)C(=O)N1 |
Computed by PubChem (NCBI)