Products 675109-30-5
CAS 675109-30-5 appears in our catalog under these names: 6–Iodoisoindolin–1–one, 6-Iodo-2,3-dihydro-1H-isoindol-1-one, 6-Iodoisoindolin-1-one 95%, 6-Iodoisoindolin-1-one, 97%, 97%, 6-Iodoisoindolin-1-one, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g.
6-iodo-2,3-dihydroisoindol-1-one (CAS 675109-30-5) is a chemical compound with the molecular formula C8H6INO and a molecular weight of 259.04 g/mol. IUPAC name: 6-iodo-2,3-dihydroisoindol-1-one. InChIKey: HWGBKJIBYIUGNE-UHFFFAOYSA-N.
| Molecular formula | C8H6INO |
|---|---|
| Molecular weight | 259.04 g/mol |
| IUPAC name | 6-iodo-2,3-dihydroisoindol-1-one |
| InChIKey | HWGBKJIBYIUGNE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)I)C(=O)N1 |
Computed by PubChem (NCBI)