cas: 3331-47-3 — see every product listed under this CAS number, including other names
5-Isopropyl-3,8-dimethylazulene-1-carbaldehyde, 97.0%, 97.0% (CAS 3331-47-3) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118GDE-200mg |
| cas | 3331-47-3 |
| size | 200mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 390.80 Pln | |
| Chemat | 1g | 1614.80 Pln |
| purity | 97.0% |
|---|---|
| delivery time | 3 weeks |
3,8-dimethyl-5-propan-2-ylazulene-1-carbaldehyde (CAS 3331-47-3) is a chemical compound with the molecular formula C16H18O and a molecular weight of 226.31 g/mol. IUPAC name: 3,8-dimethyl-5-propan-2-ylazulene-1-carbaldehyde. InChIKey: CDVRGGMPPUFSFH-UHFFFAOYSA-N.
| Molecular formula | C16H18O |
|---|---|
| Molecular weight | 226.31 g/mol |
| IUPAC name | 3,8-dimethyl-5-propan-2-ylazulene-1-carbaldehyde |
| InChIKey | CDVRGGMPPUFSFH-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC(=C2C=C(C=C1)C(C)C)C)C=O |
Computed by PubChem (NCBI)