Products 196604-19-0
CAS 196604-19-0 is the registry number for 3,3',4',5-Tetramethyldiphenyl ether, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
1-(3,4-dimethylphenoxy)-3,5-dimethylbenzene (CAS 196604-19-0) is a chemical compound with the molecular formula C16H18O and a molecular weight of 226.31 g/mol. IUPAC name: 1-(3,4-dimethylphenoxy)-3,5-dimethylbenzene. InChIKey: MDGJVBTVCHRAEJ-UHFFFAOYSA-N.
| Molecular formula | C16H18O |
|---|---|
| Molecular weight | 226.31 g/mol |
| IUPAC name | 1-(3,4-dimethylphenoxy)-3,5-dimethylbenzene |
| InChIKey | MDGJVBTVCHRAEJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OC2=CC(=CC(=C2)C)C)C |
Computed by PubChem (NCBI)