Products 17952-07-7

CAS 17952-07-7 is the registry number for 1-Butyl-4-phenoxybenzene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

1-butyl-4-phenoxybenzene (CAS 17952-07-7) is a chemical compound with the molecular formula C16H18O and a molecular weight of 226.31 g/mol. IUPAC name: 1-butyl-4-phenoxybenzene. InChIKey: GAPYMIKIYFGGKP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H18O
Molecular weight226.31 g/mol
IUPAC name1-butyl-4-phenoxybenzene
InChIKeyGAPYMIKIYFGGKP-UHFFFAOYSA-N
SMILESCCCCC1=CC=C(C=C1)OC2=CC=CC=C2

Computed by PubChem (NCBI)