cas: 1671-48-3 — see every product listed under this CAS number, including other names
5-Methanesulfonyl-2-methylaniline, ≥95%, ≥95% (CAS 1671-48-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112X5T-100mg |
| cas | 1671-48-3 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 5g | 736.40 Pln | |
| Chemat | 10g | 1413.20 Pln | |
| Chemat | 25g | 3333.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-methyl-5-methylsulfonylaniline (CAS 1671-48-3) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: 2-methyl-5-methylsulfonylaniline. InChIKey: CVZREHYXQNAPKJ-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | 2-methyl-5-methylsulfonylaniline |
| InChIKey | CVZREHYXQNAPKJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)C)N |
Computed by PubChem (NCBI)