5-Methoxy-2-nitroaniline, 98%, 98%
cas: 16133-49-6 — see every product listed under this CAS number, including other names
5-Methoxy-2-nitroaniline, 98%, 98% (CAS 16133-49-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112SDA-1g |
| cas | 16133-49-6 |
| size | 1g |
| availability | 2000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 194.00 Pln | |
| Chemat | 100g | 558.80 Pln | |
| Chemat | 50g | 318.80 Pln | |
| Chemat | 250g | 1269.20 Pln | |
| Chemat | 500g | 2500.80 Pln | |
| Chemat | 1kg | 4778.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-methoxy-2-nitroaniline (CAS 16133-49-6) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 5-methoxy-2-nitroaniline. InChIKey: QEHVRGACCVLLNN-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 5-methoxy-2-nitroaniline |
| InChIKey | QEHVRGACCVLLNN-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)