CAS 20876-29-3 appears in our catalog under these names: (5-Methoxy-2-nitro-phenyl)-acetic acid, 97%, 5-Methoxy-2-nitrophenylacetic acid, 95-<97%, 5-Methoxy-2-nitrophenylacetic acid, ≥97-<99%, 2-(5-Methoxy-2-nitrophenyl)acetic acid, 97%, 97%, 2-(5-Methoxy-2-nitrophenyl)acetic acid, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg, 50g, 100g, 200g, 300g.
2-(5-methoxy-2-nitrophenyl)acetic acid (CAS 20876-29-3) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 2-(5-methoxy-2-nitrophenyl)acetic acid. InChIKey: QBRHCFNZQWZEQM-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 2-(5-methoxy-2-nitrophenyl)acetic acid |
| InChIKey | QBRHCFNZQWZEQM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)