Products 90763-12-5
CAS 90763-12-5 appears in our catalog under these names: 2-Methoxy-4-methyl-5-nitrobenzoic acid, 97%, 2-Methoxy-4-methyl-5-nitro-benzoic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-methoxy-4-methyl-5-nitrobenzoic acid (CAS 90763-12-5) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: 2-methoxy-4-methyl-5-nitrobenzoic acid. InChIKey: AEIDTLKHBYHZHX-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | 2-methoxy-4-methyl-5-nitrobenzoic acid |
| InChIKey | AEIDTLKHBYHZHX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])C(=O)O)OC |
Computed by PubChem (NCBI)