Products 89950-93-6
CAS 89950-93-6 is the registry number for Methyl 4-(hydroxymethyl)-3-nitrobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-(hydroxymethyl)-3-nitrobenzoate (CAS 89950-93-6) is a chemical compound with the molecular formula C9H9NO5 and a molecular weight of 211.17 g/mol. IUPAC name: methyl 4-(hydroxymethyl)-3-nitrobenzoate. InChIKey: VJFYRPYYFMEHPF-UHFFFAOYSA-N.
| Molecular formula | C9H9NO5 |
|---|---|
| Molecular weight | 211.17 g/mol |
| IUPAC name | methyl 4-(hydroxymethyl)-3-nitrobenzoate |
| InChIKey | VJFYRPYYFMEHPF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)