cas: 23327-57-3 — see every product listed under this CAS number, including other names
5-Methyl-1-phenyl-3,4,5,6-tetrahydro-1H-benzo[f][1,4]oxazocine hydrochloride (CAS 23327-57-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F241971-5G |
| cas | 23327-57-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 128.10 Pln | |
| Fluorochem | 25g | 185.37 Pln |
| delivery time | 2-3 weeks |
|---|
5-methyl-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocine;hydrochloride (CAS 23327-57-3) is a chemical compound with the molecular formula C17H20ClNO and a molecular weight of 289.8 g/mol. IUPAC name: 5-methyl-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocine;hydrochloride. InChIKey: CNNVSINJDJNHQK-UHFFFAOYSA-N.
| Molecular formula | C17H20ClNO |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | 5-methyl-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocine;hydrochloride |
| InChIKey | CNNVSINJDJNHQK-UHFFFAOYSA-N |
| SMILES | CN1CCOC(C2=CC=CC=C2C1)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)