cas: 23327-57-3 — see every product listed under this CAS number, including other names
Nefopam Hydrochloride, >98.0%(HPLC)(T) (CAS 23327-57-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N1169-1G |
| cas | 23327-57-3 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 198.51 Pln | |
| TCI | 5g | 385.37 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
5-methyl-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocine;hydrochloride (CAS 23327-57-3) is a chemical compound with the molecular formula C17H20ClNO and a molecular weight of 289.8 g/mol. IUPAC name: 5-methyl-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocine;hydrochloride. InChIKey: CNNVSINJDJNHQK-UHFFFAOYSA-N.
| Molecular formula | C17H20ClNO |
|---|---|
| Molecular weight | 289.8 g/mol |
| IUPAC name | 5-methyl-1-phenyl-1,3,4,6-tetrahydro-2,5-benzoxazocine;hydrochloride |
| InChIKey | CNNVSINJDJNHQK-UHFFFAOYSA-N |
| SMILES | CN1CCOC(C2=CC=CC=C2C1)C3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)