cas: 517864-13-0 — see every product listed under this CAS number, including other names
5-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol 95% (CAS 517864-13-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A567502-10g |
| cas | 517864-13-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 15617.19 Pln | |
| Ambeed | 100mg | 882.12 Pln | |
| Ambeed | 250mg | 1371.62 Pln | |
| Ambeed | 1g | 3307.38 Pln | |
| Ambeed | 5g | 9787.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A567502 |
5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 517864-13-0) is a chemical compound with the molecular formula C13H19BO3 and a molecular weight of 234.10 g/mol. IUPAC name: 5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: KKNJXLDMVHWJGM-UHFFFAOYSA-N.
| Molecular formula | C13H19BO3 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | KKNJXLDMVHWJGM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C)O |
Computed by PubChem (NCBI)