cas: 517864-13-0 — see every product listed under this CAS number, including other names
5-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 95%, 95% (CAS 517864-13-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DL2F-100mg |
| cas | 517864-13-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 611.60 Pln | |
| Chemat | 250mg | 938.00 Pln | |
| Chemat | 500mg | 1566.80 Pln | |
| Chemat | 1g | 2253.20 Pln | |
| Chemat | 5g | 6635.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 517864-13-0) is a chemical compound with the molecular formula C13H19BO3 and a molecular weight of 234.10 g/mol. IUPAC name: 5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: KKNJXLDMVHWJGM-UHFFFAOYSA-N.
| Molecular formula | C13H19BO3 |
|---|---|
| Molecular weight | 234.10 g/mol |
| IUPAC name | 5-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | KKNJXLDMVHWJGM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C)O |
Computed by PubChem (NCBI)