cas: 85237-71-4 — see every product listed under this CAS number, including other names
5-Methyl-2-(4-methylphenyl)pyridine, 95%, 95% (CAS 85237-71-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GKVS-1g |
| cas | 85237-71-4 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 232.40 Pln | |
| Chemat | 25g | 405.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-methyl-2-(4-methylphenyl)pyridine (CAS 85237-71-4) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 5-methyl-2-(4-methylphenyl)pyridine. InChIKey: PTBRNAVGPWOGSE-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 5-methyl-2-(4-methylphenyl)pyridine |
| InChIKey | PTBRNAVGPWOGSE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC=C(C=C2)C |
Computed by PubChem (NCBI)