cas: 151276-15-2 — see every product listed under this CAS number, including other names
5-Methyl-2-(trifluoromethoxy)aniline 95+% (CAS 151276-15-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A201458-250mg |
| cas | 151276-15-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1099.06 Pln | |
| Ambeed | 1g | 2823.44 Pln | |
| Ambeed | 5g | 9709.81 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A201458 |
5-methyl-2-(trifluoromethoxy)aniline (CAS 151276-15-2) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: 5-methyl-2-(trifluoromethoxy)aniline. InChIKey: INWQECYURRPKAN-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 5-methyl-2-(trifluoromethoxy)aniline |
| InChIKey | INWQECYURRPKAN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC(F)(F)F)N |
Computed by PubChem (NCBI)