CAS 1213553-42-4 is the registry number for (R)-2-(1-Amino-2,2,2-trifluoroethyl)phenol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
2-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol (CAS 1213553-42-4) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: 2-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol. InChIKey: CAJCNRNFQRHXOB-SSDOTTSWSA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 2-[(1R)-1-amino-2,2,2-trifluoroethyl]phenol |
| InChIKey | CAJCNRNFQRHXOB-SSDOTTSWSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](C(F)(F)F)N)O |
Computed by PubChem (NCBI)