CAS 123207-61-4 appears in our catalog under these names: 3-(2,2,2-Trifluoroethoxy)aniline, 98%, 3-(2,2,2-Trifluoroethoxy)aniline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 25g.
3-(2,2,2-trifluoroethoxy)aniline (CAS 123207-61-4) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: 3-(2,2,2-trifluoroethoxy)aniline. InChIKey: IJIAMVTVXHRYIT-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | IJIAMVTVXHRYIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)(F)F)N |
Computed by PubChem (NCBI)