5-Methyl-2-(trifluoromethyl)aniline 98%
cas: 106877-29-6 — see every product listed under this CAS number, including other names
5-Methyl-2-(trifluoromethyl)aniline 98% (CAS 106877-29-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A176187-250mg |
| cas | 106877-29-6 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 275.81 Pln | |
| Ambeed | 5g | 787.56 Pln | |
| Ambeed | 10g | 1366.06 Pln | |
| Ambeed | 25g | 2851.25 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A176187 |
5-methyl-2-(trifluoromethyl)aniline (CAS 106877-29-6) is a chemical compound with the molecular formula C8H8F3N and a molecular weight of 175.15 g/mol. IUPAC name: 5-methyl-2-(trifluoromethyl)aniline. InChIKey: HYQKJEMNTMFLJA-UHFFFAOYSA-N.
| Molecular formula | C8H8F3N |
|---|---|
| Molecular weight | 175.15 g/mol |
| IUPAC name | 5-methyl-2-(trifluoromethyl)aniline |
| InChIKey | HYQKJEMNTMFLJA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)