cas: 175276-72-9 — see every product listed under this CAS number, including other names
5-Methyl-2-(trifluoromethyl)furo-3-ylacetonitrile (CAS 175276-72-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F008389-250MG |
| cas | 175276-72-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 768.50 Pln |
| delivery time | 2-3 weeks |
|---|
3-[5-methyl-2-(trifluoromethyl)furan-3-yl]-3-oxopropanenitrile (CAS 175276-72-9) is a chemical compound with the molecular formula C9H6F3NO2 and a molecular weight of 217.14 g/mol. IUPAC name: 3-[5-methyl-2-(trifluoromethyl)furan-3-yl]-3-oxopropanenitrile. InChIKey: FJIIDKSIRKJEOJ-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO2 |
|---|---|
| Molecular weight | 217.14 g/mol |
| IUPAC name | 3-[5-methyl-2-(trifluoromethyl)furan-3-yl]-3-oxopropanenitrile |
| InChIKey | FJIIDKSIRKJEOJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(O1)C(F)(F)F)C(=O)CC#N |
Computed by PubChem (NCBI)