CAS 189940-04-3 appears in our catalog under these names: 6-(Trifluoromethyl)-3,4-dihydro-2h-1,4-benzoxazin-3-one, 95%, 6-(Trifluoromethyl)-2H-1,4-benzoxazin-3(4H)-one, 98%, 6-(trifluoromethyl)-2H-1,4-benzoxazin-3(4H)-one, 98%, 98%, 6-(Trifluoromethyl)-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 10g, 5g.
6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one (CAS 189940-04-3) is a chemical compound with the molecular formula C9H6F3NO2 and a molecular weight of 217.14 g/mol. IUPAC name: 6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one. InChIKey: LRZVYXWBGNCLDB-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO2 |
|---|---|
| Molecular weight | 217.14 g/mol |
| IUPAC name | 6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one |
| InChIKey | LRZVYXWBGNCLDB-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)