Products 62248-94-6
CAS 62248-94-6 appears in our catalog under these names: (E)-1-(2-Nitrovinyl)-3-(trifluoromethyl)benzene, 95%, 1-(3-(Trifluoromethyl)phenyl)-2-nitroethene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 500mg, 1000mg, 2000mg.
1-(2-nitroethenyl)-3-(trifluoromethyl)benzene (CAS 62248-94-6) is a chemical compound with the molecular formula C9H6F3NO2 and a molecular weight of 217.14 g/mol. IUPAC name: 1-(2-nitroethenyl)-3-(trifluoromethyl)benzene. InChIKey: GOKALPUCIXWJLV-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO2 |
|---|---|
| Molecular weight | 217.14 g/mol |
| IUPAC name | 1-(2-nitroethenyl)-3-(trifluoromethyl)benzene |
| InChIKey | GOKALPUCIXWJLV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C=C[N+](=O)[O-] |
Computed by PubChem (NCBI)