cas: 578-46-1 — see every product listed under this CAS number, including other names
5-Methyl-2-nitroaniline 97% (CAS 578-46-1) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A211123-500g |
| cas | 578-46-1 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 4508.88 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 398.19 Pln | |
| Ambeed | 100g | 1182.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A211123 |
5-methyl-2-nitroaniline (CAS 578-46-1) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 5-methyl-2-nitroaniline. InChIKey: IGDYNWKWXUCIJB-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | 5-methyl-2-nitroaniline |
| InChIKey | IGDYNWKWXUCIJB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)