CAS 578-46-1 appears in our catalog under these names: 5-Methyl-2-nitroaniline, 98%, 3-Amino-4-nitrotoluene, 5–Methyl–2–nitroaniline, 5-Methyl-2-nitroaniline 97%, 5-METHYL-2-NITROANILINE, 95%. Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 100g, 25g, 1g, 100mg, 10g, 500g, 250mg.
5-methyl-2-nitroaniline (CAS 578-46-1) is a chemical compound with the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. IUPAC name: 5-methyl-2-nitroaniline. InChIKey: IGDYNWKWXUCIJB-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O2 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | 5-methyl-2-nitroaniline |
| InChIKey | IGDYNWKWXUCIJB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)