CAS 2840-46-2 appears in our catalog under these names: 5-Methyl-2-phenylbenzoic acid, 98%, 5-Methyl-2-phenylbenzoic acid, ≥95%, 5-Methyl-2-phenylbenzoic acid, 98%, 98%, 4-Methyl-(1,1'-biphenyl)-2-carboxylic acid, 98%, 4-Methyl-[1,1'-biphenyl]-2-carboxylic acid 98%. Offered by: Combi-blocks, Fluorochem, Chemat, AmBeed, Hoffman Fine Chemicals. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g, 25g, 50g, 100g.
5-methyl-2-phenylbenzoic acid (CAS 2840-46-2) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 5-methyl-2-phenylbenzoic acid. InChIKey: UUBWFNDPWDNPTE-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 5-methyl-2-phenylbenzoic acid |
| InChIKey | UUBWFNDPWDNPTE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)