cas: 91569-59-4 — see every product listed under this CAS number, including other names
5-Methyl-3-(p-tolyl)isoxazole-4-carboxylic acid 97% (CAS 91569-59-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A855350-100mg |
| cas | 91569-59-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 426.00 Pln | |
| Ambeed | 250mg | 570.62 Pln | |
| Ambeed | 1g | 1460.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A855350 |
5-methyl-3-(4-methylphenyl)-1,2-oxazole-4-carboxylic acid (CAS 91569-59-4) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 5-methyl-3-(4-methylphenyl)-1,2-oxazole-4-carboxylic acid. InChIKey: IAGFERXYANTCJG-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 5-methyl-3-(4-methylphenyl)-1,2-oxazole-4-carboxylic acid |
| InChIKey | IAGFERXYANTCJG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NOC(=C2C(=O)O)C |
Computed by PubChem (NCBI)