cas: 1256359-28-0 — see every product listed under this CAS number, including other names
5-Methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-oxadiazole, 96%, 96% (CAS 1256359-28-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BQR-100mg |
| cas | 1256359-28-0 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 458.00 Pln | |
| Chemat | 250mg | 736.40 Pln | |
| Chemat | 1g | 1826.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
5-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-oxadiazole (CAS 1256359-28-0) is a chemical compound with the molecular formula C15H19BN2O3 and a molecular weight of 286.14 g/mol. IUPAC name: 5-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-oxadiazole. InChIKey: DGFZREYHVPFDNZ-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O3 |
|---|---|
| Molecular weight | 286.14 g/mol |
| IUPAC name | 5-methyl-3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,2,4-oxadiazole |
| InChIKey | DGFZREYHVPFDNZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C3=NOC(=N3)C |
Computed by PubChem (NCBI)