Products 1416722-71-8
CAS 1416722-71-8 is the registry number for N-(3-Cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[3-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 1416722-71-8) is a chemical compound with the molecular formula C15H19BN2O3 and a molecular weight of 286.14 g/mol. IUPAC name: N-[3-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: HTVGTARCGSSCLY-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O3 |
|---|---|
| Molecular weight | 286.14 g/mol |
| IUPAC name | N-[3-cyano-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | HTVGTARCGSSCLY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)NC(=O)C)C#N |
Computed by PubChem (NCBI)