CAS 1256359-07-5 appears in our catalog under these names: 1-Acetyl-1H-indazole-6-boronic acid, pinacol ester, 96%, 1-(6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl)ethanone 98%, 1-Acetyl-1H-indazole-6-boronic acid, pinacol ester, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg.
1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]ethanone (CAS 1256359-07-5) is a chemical compound with the molecular formula C15H19BN2O3 and a molecular weight of 286.14 g/mol. IUPAC name: 1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]ethanone. InChIKey: JWJAPNZXZJVGAJ-UHFFFAOYSA-N.
| Molecular formula | C15H19BN2O3 |
|---|---|
| Molecular weight | 286.14 g/mol |
| IUPAC name | 1-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazol-1-yl]ethanone |
| InChIKey | JWJAPNZXZJVGAJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C=NN3C(=O)C |
Computed by PubChem (NCBI)