cas: 720720-96-7 — see every product listed under this CAS number, including other names
5-Methyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridine-2-carboxylic acid hydrochloride, 98%, 98% (CAS 720720-96-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FC3D-1g |
| cas | 720720-96-7 |
| size | 1g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 198.80 Pln | |
| Chemat | 50g | 304.40 Pln | |
| Chemat | 100g | 477.20 Pln | |
| Chemat | 250g | 890.00 Pln | |
| Chemat | 500g | 1512.00 Pln | |
| Chemat | 1kg | 2594.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid;hydrochloride (CAS 720720-96-7) is a chemical compound with the molecular formula C8H11ClN2O2S and a molecular weight of 234.70 g/mol. IUPAC name: 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid;hydrochloride. InChIKey: ZWIYEBIMFPQYDI-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxylic acid;hydrochloride |
| InChIKey | ZWIYEBIMFPQYDI-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)SC(=N2)C(=O)O.Cl |
Computed by PubChem (NCBI)