CAS 219688-94-5 is the registry number for 4-Chloro-2,5-dimethylbenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-chloro-2,5-dimethylbenzenesulfonohydrazide (CAS 219688-94-5) is a chemical compound with the molecular formula C8H11ClN2O2S and a molecular weight of 234.70 g/mol. IUPAC name: 4-chloro-2,5-dimethylbenzenesulfonohydrazide. InChIKey: DQBLKJSFJAFTAG-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 4-chloro-2,5-dimethylbenzenesulfonohydrazide |
| InChIKey | DQBLKJSFJAFTAG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Cl)C)S(=O)(=O)NN |
Computed by PubChem (NCBI)