CAS 76629-24-8 is the registry number for 6,7-Dihydro-5h-[1,3]thiazolo[3,2-a]pyrimidin-3-ylacetic acid hydrochloride, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g.
2-(6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)acetic acid;hydrochloride (CAS 76629-24-8) is a chemical compound with the molecular formula C8H11ClN2O2S and a molecular weight of 234.70 g/mol. IUPAC name: 2-(6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)acetic acid;hydrochloride. InChIKey: GESHCMFRCXJPOF-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 2-(6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)acetic acid;hydrochloride |
| InChIKey | GESHCMFRCXJPOF-UHFFFAOYSA-N |
| SMILES | C1CN=C2N(C1)C(=CS2)CC(=O)O.Cl |
Computed by PubChem (NCBI)