cas: 7436-07-9 — see every product listed under this CAS number, including other names
5-Nitro-2,3-dihydro-1H-indene, 95%, 95% (CAS 7436-07-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FAB5-100mg |
| cas | 7436-07-9 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 405.20 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 1994.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-nitro-2,3-dihydro-1H-indene (CAS 7436-07-9) is a chemical compound with the molecular formula C9H9NO2 and a molecular weight of 163.17 g/mol. IUPAC name: 5-nitro-2,3-dihydro-1H-indene. InChIKey: DLURUQQMVLOLCP-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | 5-nitro-2,3-dihydro-1H-indene |
| InChIKey | DLURUQQMVLOLCP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)