5-Nitrothiophene-2-carbonyl chloride, 95%
cas: 39978-57-9 — see every product listed under this CAS number, including other names
5-Nitrothiophene-2-carbonyl chloride, 95% (CAS 39978-57-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | JP-1639-1g |
| cas | 39978-57-9 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 370.38 Pln | |
| Ambeed | 5g | 1277.06 Pln | |
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 381.20 Pln | |
| Chemat | 5g | 1158.80 Pln | |
| Fluorochem | 100mg | 242.64 Pln | |
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 695.61 Pln | |
| Fluorochem | 5g | 2143.01 Pln | |
| BLDpharm | 250mg | 203.29 Pln | |
| BLDpharm | 1g | 397.66 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5-nitrothiophene-2-carbonyl chloride (CAS 39978-57-9) is a chemical compound with the molecular formula C5H2ClNO3S and a molecular weight of 191.59 g/mol. IUPAC name: 5-nitrothiophene-2-carbonyl chloride. InChIKey: BYEANWQDRDXPPA-UHFFFAOYSA-N.
| Molecular formula | C5H2ClNO3S |
|---|---|
| Molecular weight | 191.59 g/mol |
| IUPAC name | 5-nitrothiophene-2-carbonyl chloride |
| InChIKey | BYEANWQDRDXPPA-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)[N+](=O)[O-])C(=O)Cl |
Computed by PubChem (NCBI)