Products 39978-57-9

CAS 39978-57-9 appears in our catalog under these names: 5-Nitrothiophene-2-carbonyl chloride, 95%, 5-Nitrothiophene-2-carbonyl Chloride, 5-Nitrothiophene-2-carbonyl Chloride 95%, 5-Nitrothiophene-2-carbonyl Chloride, 95%, 95%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 2,5g, 5g, 100mg.

Structural formula: {0} (CAS {1})

5-nitrothiophene-2-carbonyl chloride (CAS 39978-57-9) is a chemical compound with the molecular formula C5H2ClNO3S and a molecular weight of 191.59 g/mol. IUPAC name: 5-nitrothiophene-2-carbonyl chloride. InChIKey: BYEANWQDRDXPPA-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2ClNO3S
Molecular weight191.59 g/mol
IUPAC name5-nitrothiophene-2-carbonyl chloride
InChIKeyBYEANWQDRDXPPA-UHFFFAOYSA-N
SMILESC1=C(SC(=C1)[N+](=O)[O-])C(=O)Cl

Computed by PubChem (NCBI)