Products 2825011-17-2
CAS 2825011-17-2 is the registry number for 2-(2-Chlorothiazol-4-yl)-2-oxoacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-chloro-1,3-thiazol-4-yl)-2-oxoacetic acid (CAS 2825011-17-2) is a chemical compound with the molecular formula C5H2ClNO3S and a molecular weight of 191.59 g/mol. IUPAC name: 2-(2-chloro-1,3-thiazol-4-yl)-2-oxoacetic acid. InChIKey: GZPCOMRJAIAISJ-UHFFFAOYSA-N.
| Molecular formula | C5H2ClNO3S |
|---|---|
| Molecular weight | 191.59 g/mol |
| IUPAC name | 2-(2-chloro-1,3-thiazol-4-yl)-2-oxoacetic acid |
| InChIKey | GZPCOMRJAIAISJ-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(S1)Cl)C(=O)C(=O)O |
Computed by PubChem (NCBI)