CAS 91804-56-7 appears in our catalog under these names: 5-Phenylbenzothiazole, 96%, 96%, 5-Phenylbenzo[d]thiazole, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-phenyl-1,3-benzothiazole (CAS 91804-56-7) is a chemical compound with the molecular formula C13H9NS and a molecular weight of 211.28 g/mol. IUPAC name: 5-phenyl-1,3-benzothiazole. InChIKey: AAKPXIJKSNGOCO-UHFFFAOYSA-N.
| Molecular formula | C13H9NS |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 5-phenyl-1,3-benzothiazole |
| InChIKey | AAKPXIJKSNGOCO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)SC=N3 |
Computed by PubChem (NCBI)