CAS 81820-65-7 is the registry number for 4-Phenylthieno[3,2-c]pyridine, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-phenylthieno[3,2-c]pyridine (CAS 81820-65-7) is a chemical compound with the molecular formula C13H9NS and a molecular weight of 211.28 g/mol. IUPAC name: 4-phenylthieno[3,2-c]pyridine. InChIKey: UEXKIEYHNLJFQH-UHFFFAOYSA-N.
| Molecular formula | C13H9NS |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 4-phenylthieno[3,2-c]pyridine |
| InChIKey | UEXKIEYHNLJFQH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=CC3=C2C=CS3 |
Computed by PubChem (NCBI)