CAS 19394-61-7 is the registry number for 2-Biphenyl isothiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-isothiocyanato-2-phenylbenzene (CAS 19394-61-7) is a chemical compound with the molecular formula C13H9NS and a molecular weight of 211.28 g/mol. IUPAC name: 1-isothiocyanato-2-phenylbenzene. InChIKey: OAYSYSIGKCDBKZ-UHFFFAOYSA-N.
| Molecular formula | C13H9NS |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 1-isothiocyanato-2-phenylbenzene |
| InChIKey | OAYSYSIGKCDBKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2N=C=S |
Computed by PubChem (NCBI)