5-Sulfamoylfuran-2-carboxylic acid, 98%
cas: 98027-63-5 — see every product listed under this CAS number, including other names
5-Sulfamoylfuran-2-carboxylic acid, 98% (CAS 98027-63-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g, 100mg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F540456-250MG |
| cas | 98027-63-5 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 500mg | 331.15 Pln | |
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 2.5g | 935.11 Pln | |
| Fluorochem | 5g | 1788.97 Pln | |
| Fluorochem | 10g | 3475.88 Pln | |
| Fluorochem | 25g | 8359.57 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1048.40 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
5-sulfamoylfuran-2-carboxylic acid (CAS 98027-63-5) is a chemical compound with the molecular formula C5H5NO5S and a molecular weight of 191.16 g/mol. IUPAC name: 5-sulfamoylfuran-2-carboxylic acid. InChIKey: TWICVBFROQJBSY-UHFFFAOYSA-N.
| Molecular formula | C5H5NO5S |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 5-sulfamoylfuran-2-carboxylic acid |
| InChIKey | TWICVBFROQJBSY-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)