5-Sulfamoylfuran-2-carboxylic acid, 98%
cas: 98027-63-5 — see every product listed under this CAS number, including other names
5-Sulfamoylfuran-2-carboxylic acid, 98% (CAS 98027-63-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F540456-250MG |
| cas | 98027-63-5 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 500mg | 315.53 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 2.5g | 893.45 Pln | |
| Fluorochem | 5g | 1716.08 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-sulfamoylfuran-2-carboxylic acid (CAS 98027-63-5) is a chemical compound with the molecular formula C5H5NO5S and a molecular weight of 191.16 g/mol. IUPAC name: 5-sulfamoylfuran-2-carboxylic acid. InChIKey: TWICVBFROQJBSY-UHFFFAOYSA-N.
| Molecular formula | C5H5NO5S |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 5-sulfamoylfuran-2-carboxylic acid |
| InChIKey | TWICVBFROQJBSY-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)