CAS 1423033-89-9 appears in our catalog under these names: 5-Sulfamoylfuran-3-carboxylic acid, 5-Sulfamoylfuran-3-carboxylic Acid (~90%), 95%, 95%, 5-Sulfamoylfuran-3-carboxylic acid, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g, 50mg, 500mg.
5-sulfamoylfuran-3-carboxylic acid (CAS 1423033-89-9) is a chemical compound with the molecular formula C5H5NO5S and a molecular weight of 191.16 g/mol. IUPAC name: 5-sulfamoylfuran-3-carboxylic acid. InChIKey: NMPQYEHXSISBPT-UHFFFAOYSA-N.
| Molecular formula | C5H5NO5S |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 5-sulfamoylfuran-3-carboxylic acid |
| InChIKey | NMPQYEHXSISBPT-UHFFFAOYSA-N |
| SMILES | C1=C(OC=C1C(=O)O)S(=O)(=O)N |
Computed by PubChem (NCBI)