CAS 98027-63-5 appears in our catalog under these names: 5–Sulfamoylfuran–2–carboxylic acid, 5-Sulfamoylfuran-2-carboxylic acid, 5-Sulfamoylfuran-2-carboxylic acid, 95%, 5-Sulfamoylfuran-2-carboxylic acid 97%, 5-Sulfamoylfuran-2-carboxylic acid, 98%. Offered by: GLPBio, Biosynth, Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 5g, 25g, 500mg, 2.5g.
5-sulfamoylfuran-2-carboxylic acid (CAS 98027-63-5) is a chemical compound with the molecular formula C5H5NO5S and a molecular weight of 191.16 g/mol. IUPAC name: 5-sulfamoylfuran-2-carboxylic acid. InChIKey: TWICVBFROQJBSY-UHFFFAOYSA-N.
| Molecular formula | C5H5NO5S |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 5-sulfamoylfuran-2-carboxylic acid |
| InChIKey | TWICVBFROQJBSY-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)S(=O)(=O)N)C(=O)O |
Computed by PubChem (NCBI)