cas: 2007919-12-0 — see every product listed under this CAS number, including other names
5-bromo-4-hydroxy-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid, 97%, 97% (CAS 2007919-12-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CZR-100mg |
| cas | 2007919-12-0 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 491.60 Pln | |
| Chemat | 250mg | 770.00 Pln | |
| Chemat | 500mg | 1250.00 Pln | |
| Chemat | 1g | 1845.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromo-4-oxo-1,7-dihydropyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS 2007919-12-0) is a chemical compound with the molecular formula C8H5BrN2O3 and a molecular weight of 257.04 g/mol. IUPAC name: 5-bromo-4-oxo-1,7-dihydropyrrolo[2,3-b]pyridine-3-carboxylic acid. InChIKey: PCAPAGSKCXAKIE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O3 |
|---|---|
| Molecular weight | 257.04 g/mol |
| IUPAC name | 5-bromo-4-oxo-1,7-dihydropyrrolo[2,3-b]pyridine-3-carboxylic acid |
| InChIKey | PCAPAGSKCXAKIE-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(N1)NC=C(C2=O)Br)C(=O)O |
Computed by PubChem (NCBI)