CAS 1803593-95-4 appears in our catalog under these names: 5-Bromo-6-nitro-2,3-dihydro-1H-isoindol-1-one, 95%, 5-Bromo-6-nitro-2,3-dihydro-1H-isoindol-1-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 250mg, 10g, 25g, 5g, 0,5g.
5-bromo-6-nitro-2,3-dihydroisoindol-1-one (CAS 1803593-95-4) is a chemical compound with the molecular formula C8H5BrN2O3 and a molecular weight of 257.04 g/mol. IUPAC name: 5-bromo-6-nitro-2,3-dihydroisoindol-1-one. InChIKey: NSZNCBCSKKEKTI-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O3 |
|---|---|
| Molecular weight | 257.04 g/mol |
| IUPAC name | 5-bromo-6-nitro-2,3-dihydroisoindol-1-one |
| InChIKey | NSZNCBCSKKEKTI-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2C(=O)N1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)