CAS 935269-23-1 is the registry number for 7-Bromo-4-nitroisoindolin-1-one, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-4-nitro-2,3-dihydroisoindol-1-one (CAS 935269-23-1) is a chemical compound with the molecular formula C8H5BrN2O3 and a molecular weight of 257.04 g/mol. IUPAC name: 7-bromo-4-nitro-2,3-dihydroisoindol-1-one. InChIKey: YNUCVFWNFLJQDW-UHFFFAOYSA-N.
| Molecular formula | C8H5BrN2O3 |
|---|---|
| Molecular weight | 257.04 g/mol |
| IUPAC name | 7-bromo-4-nitro-2,3-dihydroisoindol-1-one |
| InChIKey | YNUCVFWNFLJQDW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2C(=O)N1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)