cas: 1116097-04-1 — see every product listed under this CAS number, including other names
5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 97%, 97% (CAS 1116097-04-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12BG5N-100mg |
| cas | 1116097-04-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 477.20 Pln | |
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 1509.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1116097-04-1) is a chemical compound with the molecular formula C14H18BNO3 and a molecular weight of 259.11 g/mol. IUPAC name: 5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: RMJHQHSCNOVZLH-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO3 |
|---|---|
| Molecular weight | 259.11 g/mol |
| IUPAC name | 5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | RMJHQHSCNOVZLH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC)C#N |
Computed by PubChem (NCBI)