cas: 1143-50-6 — see every product listed under this CAS number, including other names
5H-Dibenzo[b,e]azepine-6,11-dione, 96% (CAS 1143-50-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092807-100MG |
| cas | 1143-50-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 232.23 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
5H-benzo[c][1]benzazepine-6,11-dione (CAS 1143-50-6) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 5H-benzo[c][1]benzazepine-6,11-dione. InChIKey: USJALFVAJSYMSN-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 5H-benzo[c][1]benzazepine-6,11-dione |
| InChIKey | USJALFVAJSYMSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)