CAS 1143-50-6 appears in our catalog under these names: 5H-Dibenzo[b,e]azepine-6,11-dione, 97%, 5H-Dibenzo[b,e]azepine-6,11-dione 98%, 5H-Dibenzo[b,e]azepine-6,11-dione, 98%, 98%, 5H-Dibenzo[b,e]azepine-6,11-dione, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g, 25g.
5H-benzo[c][1]benzazepine-6,11-dione (CAS 1143-50-6) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 5H-benzo[c][1]benzazepine-6,11-dione. InChIKey: USJALFVAJSYMSN-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 5H-benzo[c][1]benzazepine-6,11-dione |
| InChIKey | USJALFVAJSYMSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3NC2=O |
Computed by PubChem (NCBI)