Products 520-03-6
CAS 520-03-6 appears in our catalog under these names: N-Phenylphthalimide, 95%, 2–Phenylisoindole–1，3–dione, 2-Phenylisoindole-1,3-dione, 95%, 95%, 2-Phenylisoindole-1,3-dione, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 25g, 100g, 500g.
2-phenylisoindole-1,3-dione (CAS 520-03-6) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 2-phenylisoindole-1,3-dione. InChIKey: MFUPLJQNEXUUDW-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-phenylisoindole-1,3-dione |
| InChIKey | MFUPLJQNEXUUDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)
Synonyms:
N-Phenylphthalimide, Phthalanil, Phthalimide, N-phenyl-, 1H-Isoindole-1,3(2H)-dione, 2-phenyl-, 2-phenylisoindole-1,3-dione, 2-Phenyl-isoindole-1,3-Dione, 2-phenylisoindoline-1,3-dione, 2-Phenyl-1H-isoindole-1,3(2H)-dione, 2-phenyl-2,3-dihydro-1H-isoindole-1,3-dione, N-Phenyl-4-nitrophthalimide